C20H28ClNO3 — CID 170377310
tert-butyl 1-[(4-chlorophenoxy)methyl]-4-ethyl-7-azabicyclo[2.2.1]heptane-7-carboxylate (PubChem CID 170377310) has the molecular formula C20H28ClNO3 and a molecular weight of 365.90 g/mol. Its IUPAC name is tert-butyl 1-[(4-chlorophenoxy)methyl]-4-ethyl-7-azabicyclo[2.2.1]heptane-7-carboxylate.
| Compound Name | tert-butyl 1-[(4-chlorophenoxy)methyl]-4-ethyl-7-azabicyclo[2.2.1]heptane-7-carboxylate |
|---|---|
| PubChem CID | 170377310 |
| Molecular Formula | C20H28ClNO3 |
| Molecular Weight | 365.90 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | tert-butyl 1-[(4-chlorophenoxy)methyl]-4-ethyl-7-azabicyclo[2.2.1]heptane-7-carboxylate |
| SMILES | CCC12CCC(COc3ccc(Cl)cc3)(CC1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H28ClNO3/c1-5-19-10-12-20(13-11-19,22(19)17(23)25-18(2,3)4)14-24-16-8-6-15(21)7-9-16/h6-9H,5,10-14H2,1-4H3 |
| InChIKey | HEJKVNHLGUQMOB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.90 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |