C12H16N2O — CID 170382364
3-tert-butyl-6-methoxy-1H-pyrrolo[2,3-b]pyridine (PubChem CID 170382364) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-tert-butyl-6-methoxy-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-tert-butyl-6-methoxy-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 170382364 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 3-tert-butyl-6-methoxy-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc2c(C(C)(C)C)c[nH]c2n1 |
| InChI | InChI=1S/C12H16N2O/c1-12(2,3)9-7-13-11-8(9)5-6-10(14-11)15-4/h5-7H,1-4H3,(H,13,14) |
| InChIKey | MYQUTXWCJCQHPE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |