C11H14N2O2 — CID 155694720
ethane;7-methoxy-1H-1,8-naphthyridin-4-one (PubChem CID 155694720) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is ethane;7-methoxy-1H-1,8-naphthyridin-4-one.
| Compound Name | ethane;7-methoxy-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 155694720 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | ethane;7-methoxy-1H-1,8-naphthyridin-4-one |
| SMILES | CC.COc1ccc2c(=O)cc[nH]c2n1 |
| InChI | InChI=1S/C9H8N2O2.C2H6/c1-13-8-3-2-6-7(12)4-5-10-9(6)11-8;1-2/h2-5H,1H3,(H,10,11,12);1-2H3 |
| InChIKey | BKLPXYZGHFQOFS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |