C11H21NO3 — CID 170384040
[(2R,4R)-2-propan-2-yloxan-4-yl] N,N-dimethylcarbamate (PubChem CID 170384040) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is [(2R,4R)-2-propan-2-yloxan-4-yl] N,N-dimethylcarbamate.
| Compound Name | [(2R,4R)-2-propan-2-yloxan-4-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 170384040 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | [(2R,4R)-2-propan-2-yloxan-4-yl] N,N-dimethylcarbamate |
| SMILES | CC(C)[C@H]1C[C@H](OC(=O)N(C)C)CCO1 |
| InChI | InChI=1S/C11H21NO3/c1-8(2)10-7-9(5-6-14-10)15-11(13)12(3)4/h8-10H,5-7H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | SYDFETMPVCTUNU-NXEZZACHSA-N |
| XLogP | 1.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |