C22H26N2O4 — CID 170387672
benzyl N-[2-[2-[[(1S,5R)-6-bicyclo[3.1.0]hexanyl]oxy]-1-oxidopyridin-1-ium-4-yl]propan-2-yl]carbamate (PubChem CID 170387672) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is benzyl N-[2-[2-[[(1S,5R)-6-bicyclo[3.1.0]hexanyl]oxy]-1-oxidopyridin-1-ium-4-yl]propan-2-yl]carbamate.
| Compound Name | benzyl N-[2-[2-[[(1S,5R)-6-bicyclo[3.1.0]hexanyl]oxy]-1-oxidopyridin-1-ium-4-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 170387672 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | benzyl N-[2-[2-[[(1S,5R)-6-bicyclo[3.1.0]hexanyl]oxy]-1-oxidopyridin-1-ium-4-yl]propan-2-yl]carbamate |
| SMILES | CC(C)(NC(=O)OCc1ccccc1)c1cc[n+]([O-])c(OC2[C@H]3CCC[C@@H]23)c1 |
| InChI | InChI=1S/C22H26N2O4/c1-22(2,23-21(25)27-14-15-7-4-3-5-8-15)16-11-12-24(26)19(13-16)28-20-17-9-6-10-18(17)20/h3-5,7-8,11-13,17-18,20H,6,9-10,14H2,1-2H3,(H,23,25)/t17-,18+,20? |
| InChIKey | FRXXZCSFYRJPSI-UFRUDQCGSA-N |
| XLogP | 3.66 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|