C50H101NO9 — CID 170389987
6-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[6-[hydroxy(pentadecan-7-yloxy)methoxy]hexyl]amino]hexyl pentadecan-7-yl carbonate (PubChem CID 170389987) has the molecular formula C50H101NO9 and a molecular weight of 860.36 g/mol. Its IUPAC name is 6-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[6-[hydroxy(pentadecan-7-yloxy)methoxy]hexyl]amino]hexyl pentadecan-7-yl carbonate.
| Compound Name | 6-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[6-[hydroxy(pentadecan-7-yloxy)methoxy]hexyl]amino]hexyl pentadecan-7-yl carbonate |
|---|---|
| PubChem CID | 170389987 |
| Molecular Formula | C50H101NO9 |
| Molecular Weight | 860.36 g/mol |
| Exact Mass | 859.75 |
| IUPAC Name | 6-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl-[6-[hydroxy(pentadecan-7-yloxy)methoxy]hexyl]amino]hexyl pentadecan-7-yl carbonate |
| SMILES | CCCCCCCCC(CCCCCC)OC(=O)OCCCCCCN(CCCCCCOC(O)OC(CCCCCC)CCCCCCCC)CCOCCOCCO |
| InChI | InChI=1S/C50H101NO9/c1-5-9-13-17-19-27-35-47(33-25-15-11-7-3)59-49(53)57-41-31-23-21-29-37-51(39-43-55-45-46-56-44-40-52)38-30-22-24-32-42-58-50(54)60-48(34-26-16-12-8-4)36-28-20-18-14-10-6-2/h47-49,52-53H,5-46H2,1-4H3 |
| InChIKey | IDCKIXKOXAIKKE-UHFFFAOYSA-N |
| XLogP | 13.08 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.36 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|