C34H69NO8 — CID 170390090
5-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-(5-hydroxypentyl)amino]pentyl pentadecan-7-yl carbonate (PubChem CID 170390090) has the molecular formula C34H69NO8 and a molecular weight of 619.93 g/mol. Its IUPAC name is 5-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-(5-hydroxypentyl)amino]pentyl pentadecan-7-yl carbonate.
| Compound Name | 5-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-(5-hydroxypentyl)amino]pentyl pentadecan-7-yl carbonate |
|---|---|
| PubChem CID | 170390090 |
| Molecular Formula | C34H69NO8 |
| Molecular Weight | 619.93 g/mol |
| Exact Mass | 619.50 |
| IUPAC Name | 5-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl-(5-hydroxypentyl)amino]pentyl pentadecan-7-yl carbonate |
| SMILES | CCCCCCCCC(CCCCCC)OC(=O)OCCCCCN(CCCCCO)CCOCCOCCOCCO |
| InChI | InChI=1S/C34H69NO8/c1-3-5-7-9-10-14-20-33(19-13-8-6-4-2)43-34(38)42-26-18-12-16-22-35(21-15-11-17-24-36)23-27-39-29-31-41-32-30-40-28-25-37/h33,36-37H,3-32H2,1-2H3 |
| InChIKey | RHTDCADLRSYZOT-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.93 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|