C21H26ClFN4O9P2 — CID 170390254
[[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(2-fluoro-4-methylphenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 170390254) has the molecular formula C21H26ClFN4O9P2 and a molecular weight of 594.86 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(2-fluoro-4-methylphenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(2-fluoro-4-methylphenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 170390254 |
| Molecular Formula | C21H26ClFN4O9P2 |
| Molecular Weight | 594.86 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-[6-chloro-4-[[(1S)-1-(2-fluoro-4-methylphenyl)ethyl]amino]pyrazolo[5,4-b]pyridin-1-yl]-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | Cc1ccc([C@H](C)Nc2cc(Cl)nc3c2cnn3[C@@H]2O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]2O)c(F)c1 |
| InChI | InChI=1S/C21H26ClFN4O9P2/c1-10-3-4-12(14(23)5-10)11(2)25-15-6-17(22)26-20-13(15)7-24-27(20)21-19(29)18(28)16(36-21)8-35-38(33,34)9-37(30,31)32/h3-7,11,16,18-19,21,28-29H,8-9H2,1-2H3,(H,25,26)(H,33,34)(H2,30,31,32)/t11-,16+,18+,19+,21+/m0/s1 |
| InChIKey | WIYGGXXDSVVASW-WMVQMIOJSA-N |
| XLogP | 2.66 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.86 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|