C8H16O5 — CID 170397090
1-(1,3-dihydroxypropan-2-yloxymethoxy)butan-2-one (PubChem CID 170397090) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is 1-(1,3-dihydroxypropan-2-yloxymethoxy)butan-2-one.
| Compound Name | 1-(1,3-dihydroxypropan-2-yloxymethoxy)butan-2-one |
|---|---|
| PubChem CID | 170397090 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 1-(1,3-dihydroxypropan-2-yloxymethoxy)butan-2-one |
| SMILES | CCC(=O)COCOC(CO)CO |
| InChI | InChI=1S/C8H16O5/c1-2-7(11)5-12-6-13-8(3-9)4-10/h8-10H,2-6H2,1H3 |
| InChIKey | VPROSXYOLNIDAX-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|