C33H64N6O8 — CID 170397330
N-[5-[acetyl(methoxy)amino]pentyl]-N'-[5-[[4-[5-(2,2-dimethylpropylamino)pentyl-methoxyamino]-4-oxobutanoyl]amino]pentyl]-N'-methoxybutanediamide (PubChem CID 170397330) has the molecular formula C33H64N6O8 and a molecular weight of 672.91 g/mol. Its IUPAC name is N-[5-[acetyl(methoxy)amino]pentyl]-N'-[5-[[4-[5-(2,2-dimethylpropylamino)pentyl-methoxyamino]-4-oxobutanoyl]amino]pentyl]-N'-methoxybutanediamide.
| Compound Name | N-[5-[acetyl(methoxy)amino]pentyl]-N'-[5-[[4-[5-(2,2-dimethylpropylamino)pentyl-methoxyamino]-4-oxobutanoyl]amino]pentyl]-N'-methoxybutanediamide |
|---|---|
| PubChem CID | 170397330 |
| Molecular Formula | C33H64N6O8 |
| Molecular Weight | 672.91 g/mol |
| Exact Mass | 672.48 |
| IUPAC Name | N-[5-[acetyl(methoxy)amino]pentyl]-N'-[5-[[4-[5-(2,2-dimethylpropylamino)pentyl-methoxyamino]-4-oxobutanoyl]amino]pentyl]-N'-methoxybutanediamide |
| SMILES | CON(CCCCCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCNCC(C)(C)C)OC)OC)C(C)=O |
| InChI | InChI=1S/C33H64N6O8/c1-28(40)37(45-5)24-14-9-12-22-35-29(41)18-20-32(44)39(47-7)26-16-10-13-23-36-30(42)17-19-31(43)38(46-6)25-15-8-11-21-34-27-33(2,3)4/h34H,8-27H2,1-7H3,(H,35,41)(H,36,42) |
| InChIKey | SHRDPIYOVBDKOK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 158.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.91 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|