C7H10F5N — CID 170408501
(E)-3-fluoro-N-(1,1,1,2-tetrafluoropropan-2-yl)but-2-en-2-amine (PubChem CID 170408501) has the molecular formula C7H10F5N and a molecular weight of 203.15 g/mol. Its IUPAC name is (E)-3-fluoro-N-(1,1,1,2-tetrafluoropropan-2-yl)but-2-en-2-amine.
| Compound Name | (E)-3-fluoro-N-(1,1,1,2-tetrafluoropropan-2-yl)but-2-en-2-amine |
|---|---|
| PubChem CID | 170408501 |
| Molecular Formula | C7H10F5N |
| Molecular Weight | 203.15 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | (E)-3-fluoro-N-(1,1,1,2-tetrafluoropropan-2-yl)but-2-en-2-amine |
| SMILES | C/C(F)=C(/C)NC(C)(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F5N/c1-4(8)5(2)13-6(3,9)7(10,11)12/h13H,1-3H3/b5-4+ |
| InChIKey | ZBCBMSGSQHTUPH-SNAWJCMRSA-N |
| XLogP | 3.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.15 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|