C11H14N4 — CID 170417326
5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 170417326) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 170417326 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 5-(2-methylbut-3-en-2-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C=CC(C)(C)c1cc(N)n2nccc2n1 |
| InChI | InChI=1S/C11H14N4/c1-4-11(2,3)8-7-9(12)15-10(14-8)5-6-13-15/h4-7H,1,12H2,2-3H3 |
| InChIKey | AUZDTTZCCGAOOD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|