C33H44N4O4 — CID 170424438
tert-butyl N-[2-[3-[2-aminoethyl-[2-(tritylamino)ethyl]amino]-3-oxopropoxy]ethyl]carbamate (PubChem CID 170424438) has the molecular formula C33H44N4O4 and a molecular weight of 560.74 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[2-aminoethyl-[2-(tritylamino)ethyl]amino]-3-oxopropoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[2-aminoethyl-[2-(tritylamino)ethyl]amino]-3-oxopropoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 170424438 |
| Molecular Formula | C33H44N4O4 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | tert-butyl N-[2-[3-[2-aminoethyl-[2-(tritylamino)ethyl]amino]-3-oxopropoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCCC(=O)N(CCN)CCNC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H44N4O4/c1-32(2,3)41-31(39)35-22-26-40-25-19-30(38)37(23-20-34)24-21-36-33(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-18,36H,19-26,34H2,1-3H3,(H,35,39) |
| InChIKey | IGSJAXIUUBFAAX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|