C22H19FN2O4 — CID 170430554
(1S,6R,7R)-7-[(1,3-dioxoisoindol-2-yl)methyl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptane-3-carboxylic acid (PubChem CID 170430554) has the molecular formula C22H19FN2O4 and a molecular weight of 394.40 g/mol. Its IUPAC name is (1S,6R,7R)-7-[(1,3-dioxoisoindol-2-yl)methyl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptane-3-carboxylic acid.
| Compound Name | (1S,6R,7R)-7-[(1,3-dioxoisoindol-2-yl)methyl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptane-3-carboxylic acid |
|---|---|
| PubChem CID | 170430554 |
| Molecular Formula | C22H19FN2O4 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (1S,6R,7R)-7-[(1,3-dioxoisoindol-2-yl)methyl]-7-(2-fluorophenyl)-3-azabicyclo[4.1.0]heptane-3-carboxylic acid |
| SMILES | O=C(O)N1CC[C@@H]2[C@H](C1)[C@@]2(CN1C(=O)c2ccccc2C1=O)c1ccccc1F |
| InChI | InChI=1S/C22H19FN2O4/c23-18-8-4-3-7-16(18)22(15-9-10-24(21(28)29)11-17(15)22)12-25-19(26)13-5-1-2-6-14(13)20(25)27/h1-8,15,17H,9-12H2,(H,28,29)/t15-,17+,22-/m1/s1 |
| InChIKey | MATKYPLLSDTKKR-ULYRPOKDSA-N |
| XLogP | 2.99 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|