C20H17ClN4O2 — CID 170435712
(3R)-3-[[1-[(6-chloro-3-pyridinyl)amino]isoquinolin-6-yl]oxymethyl]oxolane-3-carbonitrile (PubChem CID 170435712) has the molecular formula C20H17ClN4O2 and a molecular weight of 380.84 g/mol. Its IUPAC name is (3R)-3-[[1-[(6-chloro-3-pyridinyl)amino]isoquinolin-6-yl]oxymethyl]oxolane-3-carbonitrile.
| Compound Name | (3R)-3-[[1-[(6-chloro-3-pyridinyl)amino]isoquinolin-6-yl]oxymethyl]oxolane-3-carbonitrile |
|---|---|
| PubChem CID | 170435712 |
| Molecular Formula | C20H17ClN4O2 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (3R)-3-[[1-[(6-chloro-3-pyridinyl)amino]isoquinolin-6-yl]oxymethyl]oxolane-3-carbonitrile |
| SMILES | N#C[C@]1(COc2ccc3c(Nc4ccc(Cl)nc4)nccc3c2)CCOC1 |
| InChI | InChI=1S/C20H17ClN4O2/c21-18-4-1-15(10-24-18)25-19-17-3-2-16(9-14(17)5-7-23-19)27-13-20(11-22)6-8-26-12-20/h1-5,7,9-10H,6,8,12-13H2,(H,23,25)/t20-/m1/s1 |
| InChIKey | BIQGLLGFUISFEX-HXUWFJFHSA-N |
| XLogP | 4.34 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|