C33H38F2N8O2 — CID 170438887
4-[(2S,5R)-4-[(S)-[4-(difluoromethyl)phenyl]-(4-methoxyphenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine (PubChem CID 170438887) has the molecular formula C33H38F2N8O2 and a molecular weight of 616.72 g/mol. Its IUPAC name is 4-[(2S,5R)-4-[(S)-[4-(difluoromethyl)phenyl]-(4-methoxyphenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine.
| Compound Name | 4-[(2S,5R)-4-[(S)-[4-(difluoromethyl)phenyl]-(4-methoxyphenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
|---|---|
| PubChem CID | 170438887 |
| Molecular Formula | C33H38F2N8O2 |
| Molecular Weight | 616.72 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | 4-[(2S,5R)-4-[(S)-[4-(difluoromethyl)phenyl]-(4-methoxyphenyl)methyl]-2,5-dimethylpiperazin-1-yl]-2-methyl-1-[[(2S)-oxolan-2-yl]methyl]-[1,2,4]triazolo[3,4-b]purine |
| SMILES | COc1ccc([C@H](c2ccc(C(F)F)cc2)N2C[C@H](C)N(c3nc4nncn4c4c3nc(C)n4C[C@@H]3CCCO3)C[C@H]2C)cc1 |
| InChI | InChI=1S/C33H38F2N8O2/c1-20-17-41(31-28-32(43-19-36-39-33(43)38-31)42(22(3)37-28)18-27-6-5-15-45-27)21(2)16-40(20)29(24-11-13-26(44-4)14-12-24)23-7-9-25(10-8-23)30(34)35/h7-14,19-21,27,29-30H,5-6,15-18H2,1-4H3/t20-,21+,27+,29+/m1/s1 |
| InChIKey | AUYIVFSNBAXCNG-YDWBPBGQSA-N |
| XLogP | 5.60 |
| TPSA | 85.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.72 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |