C23H21N5O4 — CID 170439322
N-[[5-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2,4-dioxo-1H-benzo[i][1,5]benzodiazepin-10-yl]methyl]acetamide (PubChem CID 170439322) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is N-[[5-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2,4-dioxo-1H-benzo[i][1,5]benzodiazepin-10-yl]methyl]acetamide.
| Compound Name | N-[[5-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2,4-dioxo-1H-benzo[i][1,5]benzodiazepin-10-yl]methyl]acetamide |
|---|---|
| PubChem CID | 170439322 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[[5-[3-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2,4-dioxo-1H-benzo[i][1,5]benzodiazepin-10-yl]methyl]acetamide |
| SMILES | CC(=O)NCc1ccc2ccc3c(c2c1)NC(=O)CC(=O)N3c1cccc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C23H21N5O4/c1-13(29)25-12-14-5-6-15-7-8-19-22(18(15)9-14)26-20(30)11-21(31)28(19)17-4-2-3-16(10-17)23(24)27-32/h2-10,32H,11-12H2,1H3,(H2,24,27)(H,25,29)(H,26,30) |
| InChIKey | XXCKLMHWWYRRJR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 137.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|