C21H15N3O3 — CID 56643939
5-(3-methyl-1,2-benzoxazol-6-yl)-1H-benzo[g][1,5]benzodiazepine-2,4-dione (PubChem CID 56643939) has the molecular formula C21H15N3O3 and a molecular weight of 357.37 g/mol. Its IUPAC name is 5-(3-methyl-1,2-benzoxazol-6-yl)-1H-benzo[g][1,5]benzodiazepine-2,4-dione.
| Compound Name | 5-(3-methyl-1,2-benzoxazol-6-yl)-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 56643939 |
| Molecular Formula | C21H15N3O3 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 5-(3-methyl-1,2-benzoxazol-6-yl)-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| SMILES | Cc1noc2cc(N3C(=O)CC(=O)Nc4c3ccc3ccccc43)ccc12 |
| InChI | InChI=1S/C21H15N3O3/c1-12-15-8-7-14(10-18(15)27-23-12)24-17-9-6-13-4-2-3-5-16(13)21(17)22-19(25)11-20(24)26/h2-10H,11H2,1H3,(H,22,25) |
| InChIKey | NYFQRUULOPULTG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|