C20H14N6O2 — CID 46873627
5-[2-(5H-tetrazol-5-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione (PubChem CID 46873627) has the molecular formula C20H14N6O2 and a molecular weight of 370.37 g/mol. Its IUPAC name is 5-[2-(5H-tetrazol-5-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione.
| Compound Name | 5-[2-(5H-tetrazol-5-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 46873627 |
| Molecular Formula | C20H14N6O2 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 5-[2-(5H-tetrazol-5-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| SMILES | O=C1CC(=O)N(c2ccccc2C2N=NN=N2)c2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C20H14N6O2/c27-17-11-18(28)26(15-8-4-3-7-14(15)20-22-24-25-23-20)16-10-9-12-5-1-2-6-13(12)19(16)21-17/h1-10,20H,11H2,(H,21,27) |
| InChIKey | HIVPCOYKRASGNP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|