C21H14N4O4 — CID 135957054
5-[3-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione (PubChem CID 135957054) has the molecular formula C21H14N4O4 and a molecular weight of 386.37 g/mol. Its IUPAC name is 5-[3-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione.
| Compound Name | 5-[3-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 135957054 |
| Molecular Formula | C21H14N4O4 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 5-[3-(5-oxo-4H-1,2,4-oxadiazol-3-yl)phenyl]-1H-benzo[g][1,5]benzodiazepine-2,4-dione |
| SMILES | O=C1CC(=O)N(c2cccc(-c3noc(=O)[nH]3)c2)c2ccc3ccccc3c2N1 |
| InChI | InChI=1S/C21H14N4O4/c26-17-11-18(27)25(14-6-3-5-13(10-14)20-23-21(28)29-24-20)16-9-8-12-4-1-2-7-15(12)19(16)22-17/h1-10H,11H2,(H,22,26)(H,23,24,28) |
| InChIKey | OVFQCMGLZBSLNR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|