C50H34O4 — CID 170440773
2,10-bis(9,9-dimethylfluoren-4-yl)chromeno[2,3-a]xanthene-8,14-dione (PubChem CID 170440773) has the molecular formula C50H34O4 and a molecular weight of 698.82 g/mol. Its IUPAC name is 2,10-bis(9,9-dimethylfluoren-4-yl)chromeno[2,3-a]xanthene-8,14-dione.
| Compound Name | 2,10-bis(9,9-dimethylfluoren-4-yl)chromeno[2,3-a]xanthene-8,14-dione |
|---|---|
| PubChem CID | 170440773 |
| Molecular Formula | C50H34O4 |
| Molecular Weight | 698.82 g/mol |
| Exact Mass | 698.25 |
| IUPAC Name | 2,10-bis(9,9-dimethylfluoren-4-yl)chromeno[2,3-a]xanthene-8,14-dione |
| SMILES | CC1(C)c2ccccc2-c2c(-c3ccc4oc5c(ccc6oc7ccc(-c8cccc9c8-c8ccccc8C9(C)C)cc7c(=O)c65)c(=O)c4c3)cccc21 |
| InChI | InChI=1S/C50H34O4/c1-49(2)36-15-7-5-11-31(36)43-29(13-9-17-38(43)49)27-20-23-41-34(25-27)46(51)33-21-24-42-45(48(33)54-41)47(52)35-26-28(19-22-40(35)53-42)30-14-10-18-39-44(30)32-12-6-8-16-37(32)50(39,3)4/h5-26H,1-4H3 |
| InChIKey | XKWQZQUDNZHEOY-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.82 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|