C16H22N4O2S2 — CID 170442826
1-N,4-N-bis[(E)-3-sulfanylbutan-2-ylideneamino]benzene-1,4-dicarboxamide (PubChem CID 170442826) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 1-N,4-N-bis[(E)-3-sulfanylbutan-2-ylideneamino]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[(E)-3-sulfanylbutan-2-ylideneamino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 170442826 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 1-N,4-N-bis[(E)-3-sulfanylbutan-2-ylideneamino]benzene-1,4-dicarboxamide |
| SMILES | C/C(=N\NC(=O)c1ccc(C(=O)N/N=C(\C)C(C)S)cc1)C(C)S |
| InChI | InChI=1S/C16H22N4O2S2/c1-9(11(3)23)17-19-15(21)13-5-7-14(8-6-13)16(22)20-18-10(2)12(4)24/h5-8,11-12,23-24H,1-4H3,(H,19,21)(H,20,22)/b17-9+,18-10+ |
| InChIKey | KKZDUSUMRFVZRQ-BEQMOXJMSA-N |
| XLogP | 2.53 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|