C21H24O4 — CID 170443109
1-(2-naphthalen-2-ylbutan-2-yloxycarbonyl)cyclopentane-1-carboxylic acid (PubChem CID 170443109) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-(2-naphthalen-2-ylbutan-2-yloxycarbonyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(2-naphthalen-2-ylbutan-2-yloxycarbonyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 170443109 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-(2-naphthalen-2-ylbutan-2-yloxycarbonyl)cyclopentane-1-carboxylic acid |
| SMILES | CCC(C)(OC(=O)C1(C(=O)O)CCCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H24O4/c1-3-20(2,17-11-10-15-8-4-5-9-16(15)14-17)25-19(24)21(18(22)23)12-6-7-13-21/h4-5,8-11,14H,3,6-7,12-13H2,1-2H3,(H,22,23) |
| InChIKey | LQRTXOXOIZHEQZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|