C16H35N2O5S+ — CID 170444847
[(5R)-5-carboxy-5-(methylamino)pentyl]-dipropyl-(3-sulfopropyl)azanium (PubChem CID 170444847) has the molecular formula C16H35N2O5S+ and a molecular weight of 367.53 g/mol. Its IUPAC name is [(5R)-5-carboxy-5-(methylamino)pentyl]-dipropyl-(3-sulfopropyl)azanium.
| Compound Name | [(5R)-5-carboxy-5-(methylamino)pentyl]-dipropyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 170444847 |
| Molecular Formula | C16H35N2O5S+ |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | [(5R)-5-carboxy-5-(methylamino)pentyl]-dipropyl-(3-sulfopropyl)azanium |
| SMILES | CCC[N+](CCC)(CCCC[C@@H](NC)C(=O)O)CCCS(=O)(=O)O |
| InChI | InChI=1S/C16H34N2O5S/c1-4-10-18(11-5-2,13-8-14-24(21,22)23)12-7-6-9-15(17-3)16(19)20/h15,17H,4-14H2,1-3H3,(H-,19,20,21,22,23)/p+1/t15-/m1/s1 |
| InChIKey | UAZGDFYJTRJGIF-OAHLLOKOSA-O |
| XLogP | 1.74 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|