C9H20N2O3S — CID 170770396
(2S)-4-(butylsulfonimidoyl)-2-(methylamino)butanoic acid (PubChem CID 170770396) has the molecular formula C9H20N2O3S and a molecular weight of 236.34 g/mol. Its IUPAC name is (2S)-4-(butylsulfonimidoyl)-2-(methylamino)butanoic acid.
| Compound Name | (2S)-4-(butylsulfonimidoyl)-2-(methylamino)butanoic acid |
|---|---|
| PubChem CID | 170770396 |
| Molecular Formula | C9H20N2O3S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (2S)-4-(butylsulfonimidoyl)-2-(methylamino)butanoic acid |
| SMILES | [H]N=S(=O)(CCCC)CC[C@H](NC)C(=O)O |
| InChI | InChI=1S/C9H20N2O3S/c1-3-4-6-15(10,14)7-5-8(11-2)9(12)13/h8,10-11H,3-7H2,1-2H3,(H,12,13)/t8-,15?/m0/s1 |
| InChIKey | AAZDXLABZKMXBN-CYQMCQFNSA-N |
| XLogP | 0.90 |
| TPSA | 90.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |