C27H34N6O2 — CID 170445235
4-[3-[[2-amino-5-[1-(3,4,5-trimethylpiperazin-1-yl)pyrazol-4-yl]-3-pyridinyl]oxymethyl]phenyl]-2-methylbut-3-yn-2-ol (PubChem CID 170445235) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 4-[3-[[2-amino-5-[1-(3,4,5-trimethylpiperazin-1-yl)pyrazol-4-yl]-3-pyridinyl]oxymethyl]phenyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[3-[[2-amino-5-[1-(3,4,5-trimethylpiperazin-1-yl)pyrazol-4-yl]-3-pyridinyl]oxymethyl]phenyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 170445235 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 4-[3-[[2-amino-5-[1-(3,4,5-trimethylpiperazin-1-yl)pyrazol-4-yl]-3-pyridinyl]oxymethyl]phenyl]-2-methylbut-3-yn-2-ol |
| SMILES | CC1CN(n2cc(-c3cnc(N)c(OCc4cccc(C#CC(C)(C)O)c4)c3)cn2)CC(C)N1C |
| InChI | InChI=1S/C27H34N6O2/c1-19-15-32(16-20(2)31(19)5)33-17-24(14-30-33)23-12-25(26(28)29-13-23)35-18-22-8-6-7-21(11-22)9-10-27(3,4)34/h6-8,11-14,17,19-20,34H,15-16,18H2,1-5H3,(H2,28,29) |
| InChIKey | ZPCAAFAOWDLVNA-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|