C30H37N5O2 — CID 170445197
4-[3-[[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-3-pyridinyl]oxymethyl]phenyl]-2-cyclopentylbut-3-yn-2-ol (PubChem CID 170445197) has the molecular formula C30H37N5O2 and a molecular weight of 499.66 g/mol. Its IUPAC name is 4-[3-[[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-3-pyridinyl]oxymethyl]phenyl]-2-cyclopentylbut-3-yn-2-ol.
| Compound Name | 4-[3-[[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-3-pyridinyl]oxymethyl]phenyl]-2-cyclopentylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 170445197 |
| Molecular Formula | C30H37N5O2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 4-[3-[[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-3-pyridinyl]oxymethyl]phenyl]-2-cyclopentylbut-3-yn-2-ol |
| SMILES | CN1CCC(n2cc(-c3cnc(N)c(OCc4cccc(C#CC(C)(O)C5CCCC5)c4)c3)cn2)CC1 |
| InChI | InChI=1S/C30H37N5O2/c1-30(36,26-8-3-4-9-26)13-10-22-6-5-7-23(16-22)21-37-28-17-24(18-32-29(28)31)25-19-33-35(20-25)27-11-14-34(2)15-12-27/h5-7,16-20,26-27,36H,3-4,8-9,11-12,14-15,21H2,1-2H3,(H2,31,32) |
| InChIKey | UUOIAJQQIKWJLO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|