C28H35N5O2 — CID 170533280
1-[3-[[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-3-pyridinyl]oxy-dideuteriomethyl]phenyl]-3-ethylpent-1-yn-3-ol (PubChem CID 170533280) has the molecular formula C28H35N5O2 and a molecular weight of 475.63 g/mol. Its IUPAC name is 1-[3-[[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-3-pyridinyl]oxy-dideuteriomethyl]phenyl]-3-ethylpent-1-yn-3-ol.
| Compound Name | 1-[3-[[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-3-pyridinyl]oxy-dideuteriomethyl]phenyl]-3-ethylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 170533280 |
| Molecular Formula | C28H35N5O2 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | 1-[3-[[2-amino-5-[1-(1-methylpiperidin-4-yl)pyrazol-4-yl]-3-pyridinyl]oxy-dideuteriomethyl]phenyl]-3-ethylpent-1-yn-3-ol |
| SMILES | [2H]C([2H])(Oc1cc(-c2cnn(C3CCN(C)CC3)c2)cnc1N)c1cccc(C#CC(O)(CC)CC)c1 |
| InChI | InChI=1S/C28H35N5O2/c1-4-28(34,5-2)12-9-21-7-6-8-22(15-21)20-35-26-16-23(17-30-27(26)29)24-18-31-33(19-24)25-10-13-32(3)14-11-25/h6-8,15-19,25,34H,4-5,10-11,13-14,20H2,1-3H3,(H2,29,30)/i20D2 |
| InChIKey | BWIJPBNQVMACCE-FCLBBQIASA-N |
| XLogP | 4.28 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|