C28H31N3O2 — CID 176896896
4-[3-[[2-amino-5-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-pyridinyl]oxymethyl]phenyl]-2-methylbut-3-yn-2-ol (PubChem CID 176896896) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 4-[3-[[2-amino-5-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-pyridinyl]oxymethyl]phenyl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[3-[[2-amino-5-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-pyridinyl]oxymethyl]phenyl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 176896896 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 4-[3-[[2-amino-5-(2,5-dimethyl-3,4-dihydro-1H-isoquinolin-7-yl)-3-pyridinyl]oxymethyl]phenyl]-2-methylbut-3-yn-2-ol |
| SMILES | Cc1cc(-c2cnc(N)c(OCc3cccc(C#CC(C)(C)O)c3)c2)cc2c1CCN(C)C2 |
| InChI | InChI=1S/C28H31N3O2/c1-19-12-22(14-24-17-31(4)11-9-25(19)24)23-15-26(27(29)30-16-23)33-18-21-7-5-6-20(13-21)8-10-28(2,3)32/h5-7,12-16,32H,9,11,17-18H2,1-4H3,(H2,29,30) |
| InChIKey | XQZAWNCLAGCBEE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|