C28H34N4OS — CID 162020196
3-[[3-(3,3-dimethylbut-1-ynyl)phenyl]methoxy]-5-[2-(1-ethylpiperidin-4-yl)-1,3-thiazol-5-yl]pyridin-2-amine (PubChem CID 162020196) has the molecular formula C28H34N4OS and a molecular weight of 474.67 g/mol. Its IUPAC name is 3-[[3-(3,3-dimethylbut-1-ynyl)phenyl]methoxy]-5-[2-(1-ethylpiperidin-4-yl)-1,3-thiazol-5-yl]pyridin-2-amine.
| Compound Name | 3-[[3-(3,3-dimethylbut-1-ynyl)phenyl]methoxy]-5-[2-(1-ethylpiperidin-4-yl)-1,3-thiazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 162020196 |
| Molecular Formula | C28H34N4OS |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 3-[[3-(3,3-dimethylbut-1-ynyl)phenyl]methoxy]-5-[2-(1-ethylpiperidin-4-yl)-1,3-thiazol-5-yl]pyridin-2-amine |
| SMILES | CCN1CCC(c2ncc(-c3cnc(N)c(OCc4cccc(C#CC(C)(C)C)c4)c3)s2)CC1 |
| InChI | InChI=1S/C28H34N4OS/c1-5-32-13-10-22(11-14-32)27-31-18-25(34-27)23-16-24(26(29)30-17-23)33-19-21-8-6-7-20(15-21)9-12-28(2,3)4/h6-8,15-18,22H,5,10-11,13-14,19H2,1-4H3,(H2,29,30) |
| InChIKey | FSGVXNISMPQBFH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|