C40H56N4OS — CID 167614035
5-[2-(1-tert-butylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-[[2,3-ditert-butyl-5-(3-cyclopropyl-3-methylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine (PubChem CID 167614035) has the molecular formula C40H56N4OS and a molecular weight of 640.98 g/mol. Its IUPAC name is 5-[2-(1-tert-butylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-[[2,3-ditert-butyl-5-(3-cyclopropyl-3-methylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine.
| Compound Name | 5-[2-(1-tert-butylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-[[2,3-ditert-butyl-5-(3-cyclopropyl-3-methylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 167614035 |
| Molecular Formula | C40H56N4OS |
| Molecular Weight | 640.98 g/mol |
| Exact Mass | 640.42 |
| IUPAC Name | 5-[2-(1-tert-butylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-[[2,3-ditert-butyl-5-(3-cyclopropyl-3-methylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine |
| SMILES | CC(C)(C)c1cc(C#CC(C)(C)C2CC2)cc(COc2cc(-c3cnc(C4CCN(C(C)(C)C)CC4)s3)cnc2N)c1C(C)(C)C |
| InChI | InChI=1S/C40H56N4OS/c1-37(2,3)31-21-26(14-17-40(10,11)30-12-13-30)20-29(34(31)38(4,5)6)25-45-32-22-28(23-42-35(32)41)33-24-43-36(46-33)27-15-18-44(19-16-27)39(7,8)9/h20-24,27,30H,12-13,15-16,18-19,25H2,1-11H3,(H2,41,42) |
| InChIKey | DDTSWUFJMTWDSN-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.98 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|