C27H32N4S — CID 159768744
3-[2-[3-(3,3-dimethylbut-1-ynyl)phenyl]ethyl]-5-(2-piperidin-4-yl-1,3-thiazol-5-yl)pyridin-2-amine (PubChem CID 159768744) has the molecular formula C27H32N4S and a molecular weight of 444.65 g/mol. Its IUPAC name is 3-[2-[3-(3,3-dimethylbut-1-ynyl)phenyl]ethyl]-5-(2-piperidin-4-yl-1,3-thiazol-5-yl)pyridin-2-amine.
| Compound Name | 3-[2-[3-(3,3-dimethylbut-1-ynyl)phenyl]ethyl]-5-(2-piperidin-4-yl-1,3-thiazol-5-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 159768744 |
| Molecular Formula | C27H32N4S |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 3-[2-[3-(3,3-dimethylbut-1-ynyl)phenyl]ethyl]-5-(2-piperidin-4-yl-1,3-thiazol-5-yl)pyridin-2-amine |
| SMILES | CC(C)(C)C#Cc1cccc(CCc2cc(-c3cnc(C4CCNCC4)s3)cnc2N)c1 |
| InChI | InChI=1S/C27H32N4S/c1-27(2,3)12-9-20-6-4-5-19(15-20)7-8-22-16-23(17-30-25(22)28)24-18-31-26(32-24)21-10-13-29-14-11-21/h4-6,15-18,21,29H,7-8,10-11,13-14H2,1-3H3,(H2,28,30) |
| InChIKey | UTVUEUXUAADBHL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|