C28H30N4O3S — CID 158487752
2-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]-2-hydroxycyclopentan-1-one (PubChem CID 158487752) has the molecular formula C28H30N4O3S and a molecular weight of 502.64 g/mol. Its IUPAC name is 2-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]-2-hydroxycyclopentan-1-one.
| Compound Name | 2-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]-2-hydroxycyclopentan-1-one |
|---|---|
| PubChem CID | 158487752 |
| Molecular Formula | C28H30N4O3S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 2-[2-[3-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]-2-hydroxycyclopentan-1-one |
| SMILES | CN1CCC(c2ncc(-c3cnc(N)c(OCc4cccc(C#CC5(O)CCCC5=O)c4)c3)s2)CC1 |
| InChI | InChI=1S/C28H30N4O3S/c1-32-12-8-21(9-13-32)27-31-17-24(36-27)22-15-23(26(29)30-16-22)35-18-20-5-2-4-19(14-20)7-11-28(34)10-3-6-25(28)33/h2,4-5,14-17,21,34H,3,6,8-10,12-13,18H2,1H3,(H2,29,30) |
| InChIKey | YUMYESJWDQYSNA-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|