C20H21N3O2S — CID 158487748
5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-phenylmethoxypyridin-2-amine (PubChem CID 158487748) has the molecular formula C20H21N3O2S and a molecular weight of 367.47 g/mol. Its IUPAC name is 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-phenylmethoxypyridin-2-amine.
| Compound Name | 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-phenylmethoxypyridin-2-amine |
|---|---|
| PubChem CID | 158487748 |
| Molecular Formula | C20H21N3O2S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 5-[2-(oxan-4-yl)-1,3-thiazol-5-yl]-3-phenylmethoxypyridin-2-amine |
| SMILES | Nc1ncc(-c2cnc(C3CCOCC3)s2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H21N3O2S/c21-19-17(25-13-14-4-2-1-3-5-14)10-16(11-22-19)18-12-23-20(26-18)15-6-8-24-9-7-15/h1-5,10-12,15H,6-9,13H2,(H2,21,22) |
| InChIKey | UQGXBLHBOSJEPK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|