C27H29F3N4O2S — CID 170056665
5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-[[3-(4,4,4-trifluoro-3-methoxy-3-methylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine (PubChem CID 170056665) has the molecular formula C27H29F3N4O2S and a molecular weight of 530.62 g/mol. Its IUPAC name is 5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-[[3-(4,4,4-trifluoro-3-methoxy-3-methylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine.
| Compound Name | 5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-[[3-(4,4,4-trifluoro-3-methoxy-3-methylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 170056665 |
| Molecular Formula | C27H29F3N4O2S |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-[[3-(4,4,4-trifluoro-3-methoxy-3-methylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine |
| SMILES | COC(C)(C#Cc1cccc(COc2cc(-c3cnc(C4CCN(C)CC4)s3)cnc2N)c1)C(F)(F)F |
| InChI | InChI=1S/C27H29F3N4O2S/c1-26(35-3,27(28,29)30)10-7-18-5-4-6-19(13-18)17-36-22-14-21(15-32-24(22)31)23-16-33-25(37-23)20-8-11-34(2)12-9-20/h4-6,13-16,20H,8-9,11-12,17H2,1-3H3,(H2,31,32) |
| InChIKey | SAGDXHFCZIJUBK-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|