C27H28IN4O4PS — CID 166728305
iodo-[1-[2-[3-[[5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-2-nitro-3-pyridinyl]oxymethyl]phenyl]ethynyl]cyclobutyl]oxyphosphane (PubChem CID 166728305) has the molecular formula C27H28IN4O4PS and a molecular weight of 662.49 g/mol. Its IUPAC name is iodo-[1-[2-[3-[[5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-2-nitro-3-pyridinyl]oxymethyl]phenyl]ethynyl]cyclobutyl]oxyphosphane.
| Compound Name | iodo-[1-[2-[3-[[5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-2-nitro-3-pyridinyl]oxymethyl]phenyl]ethynyl]cyclobutyl]oxyphosphane |
|---|---|
| PubChem CID | 166728305 |
| Molecular Formula | C27H28IN4O4PS |
| Molecular Weight | 662.49 g/mol |
| Exact Mass | 662.06 |
| IUPAC Name | iodo-[1-[2-[3-[[5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-2-nitro-3-pyridinyl]oxymethyl]phenyl]ethynyl]cyclobutyl]oxyphosphane |
| SMILES | CN1CCC(c2ncc(-c3cnc([N+](=O)[O-])c(OCc4cccc(C#CC5(OPI)CCC5)c4)c3)s2)CC1 |
| InChI | InChI=1S/C27H28IN4O4PS/c1-31-12-7-21(8-13-31)26-30-17-24(38-26)22-15-23(25(29-16-22)32(33)34)35-18-20-5-2-4-19(14-20)6-11-27(36-37-28)9-3-10-27/h2,4-5,14-17,21,37H,3,7-10,12-13,18H2,1H3 |
| InChIKey | YGJRGMDICSPPSD-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 90.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.49 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|