C27H30N4O4S — CID 170056378
4-[7-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-1,3-benzodioxol-5-yl]-2-methylbut-3-yn-2-ol (PubChem CID 170056378) has the molecular formula C27H30N4O4S and a molecular weight of 506.63 g/mol. Its IUPAC name is 4-[7-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-1,3-benzodioxol-5-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[7-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-1,3-benzodioxol-5-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 170056378 |
| Molecular Formula | C27H30N4O4S |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 4-[7-[[2-amino-5-[2-(1-methylpiperidin-4-yl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]-1,3-benzodioxol-5-yl]-2-methylbut-3-yn-2-ol |
| SMILES | CN1CCC(c2ncc(-c3cnc(N)c(OCc4cc(C#CC(C)(C)O)cc5c4OCO5)c3)s2)CC1 |
| InChI | InChI=1S/C27H30N4O4S/c1-27(2,32)7-4-17-10-20(24-21(11-17)34-16-35-24)15-33-22-12-19(13-29-25(22)28)23-14-30-26(36-23)18-5-8-31(3)9-6-18/h10-14,18,32H,5-6,8-9,15-16H2,1-3H3,(H2,28,29) |
| InChIKey | MIJVXPBXXGSYRP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|