C26H28N4O2S — CID 166900648
1-[2-[3-[[2-amino-5-[2-(4-aminocyclohexyl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]cyclopropan-1-ol (PubChem CID 166900648) has the molecular formula C26H28N4O2S and a molecular weight of 460.60 g/mol. Its IUPAC name is 1-[2-[3-[[2-amino-5-[2-(4-aminocyclohexyl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]cyclopropan-1-ol.
| Compound Name | 1-[2-[3-[[2-amino-5-[2-(4-aminocyclohexyl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 166900648 |
| Molecular Formula | C26H28N4O2S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 1-[2-[3-[[2-amino-5-[2-(4-aminocyclohexyl)-1,3-thiazol-5-yl]-3-pyridinyl]oxymethyl]phenyl]ethynyl]cyclopropan-1-ol |
| SMILES | Nc1ncc(-c2cnc(C3CCC(N)CC3)s2)cc1OCc1cccc(C#CC2(O)CC2)c1 |
| InChI | InChI=1S/C26H28N4O2S/c27-21-6-4-19(5-7-21)25-30-15-23(33-25)20-13-22(24(28)29-14-20)32-16-18-3-1-2-17(12-18)8-9-26(31)10-11-26/h1-3,12-15,19,21,31H,4-7,10-11,16,27H2,(H2,28,29) |
| InChIKey | HTILOLGMZRNHRN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|