C38H54N4OSe — CID 167553409
5-[2-(1-tert-butylpiperidin-4-yl)-1,3-selenazol-5-yl]-3-[[2,3-ditert-butyl-5-(3,3-dimethylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine (PubChem CID 167553409) has the molecular formula C38H54N4OSe and a molecular weight of 661.84 g/mol. Its IUPAC name is 5-[2-(1-tert-butylpiperidin-4-yl)-1,3-selenazol-5-yl]-3-[[2,3-ditert-butyl-5-(3,3-dimethylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine.
| Compound Name | 5-[2-(1-tert-butylpiperidin-4-yl)-1,3-selenazol-5-yl]-3-[[2,3-ditert-butyl-5-(3,3-dimethylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 167553409 |
| Molecular Formula | C38H54N4OSe |
| Molecular Weight | 661.84 g/mol |
| Exact Mass | 662.35 |
| IUPAC Name | 5-[2-(1-tert-butylpiperidin-4-yl)-1,3-selenazol-5-yl]-3-[[2,3-ditert-butyl-5-(3,3-dimethylbut-1-ynyl)phenyl]methoxy]pyridin-2-amine |
| SMILES | CC(C)(C)C#Cc1cc(COc2cc(-c3cnc(C4CCN(C(C)(C)C)CC4)[se]3)cnc2N)c(C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H54N4OSe/c1-35(2,3)16-13-25-19-28(32(37(7,8)9)29(20-25)36(4,5)6)24-43-30-21-27(22-40-33(30)39)31-23-41-34(44-31)26-14-17-42(18-15-26)38(10,11)12/h19-23,26H,14-15,17-18,24H2,1-12H3,(H2,39,40) |
| InChIKey | QQXUXZOYVMHFGD-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.84 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|