C31H45N5OS — CID 167572918
5-[2-(4-tert-butylpiperazin-1-yl)-1,3-thiazol-5-yl]-3-[(2,3-ditert-butylphenyl)methoxy]pyridin-2-amine (PubChem CID 167572918) has the molecular formula C31H45N5OS and a molecular weight of 535.80 g/mol. Its IUPAC name is 5-[2-(4-tert-butylpiperazin-1-yl)-1,3-thiazol-5-yl]-3-[(2,3-ditert-butylphenyl)methoxy]pyridin-2-amine.
| Compound Name | 5-[2-(4-tert-butylpiperazin-1-yl)-1,3-thiazol-5-yl]-3-[(2,3-ditert-butylphenyl)methoxy]pyridin-2-amine |
|---|---|
| PubChem CID | 167572918 |
| Molecular Formula | C31H45N5OS |
| Molecular Weight | 535.80 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | 5-[2-(4-tert-butylpiperazin-1-yl)-1,3-thiazol-5-yl]-3-[(2,3-ditert-butylphenyl)methoxy]pyridin-2-amine |
| SMILES | CC(C)(C)c1cccc(COc2cc(-c3cnc(N4CCN(C(C)(C)C)CC4)s3)cnc2N)c1C(C)(C)C |
| InChI | InChI=1S/C31H45N5OS/c1-29(2,3)23-12-10-11-21(26(23)30(4,5)6)20-37-24-17-22(18-33-27(24)32)25-19-34-28(38-25)35-13-15-36(16-14-35)31(7,8)9/h10-12,17-19H,13-16,20H2,1-9H3,(H2,32,33) |
| InChIKey | UMGKTFXSCZRJOJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.80 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_C(3)', 'substructure': 'N/A'} |
|---|