C29H33Cl2N9O — CID 170445749
7-[(2S,5R)-4-[bis(4-chlorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-4-methanimidoyl-3-[[(2R)-oxolan-2-yl]methyl]triazolo[4,5-d]pyrimidin-5-imine (PubChem CID 170445749) has the molecular formula C29H33Cl2N9O and a molecular weight of 594.55 g/mol. Its IUPAC name is 7-[(2S,5R)-4-[bis(4-chlorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-4-methanimidoyl-3-[[(2R)-oxolan-2-yl]methyl]triazolo[4,5-d]pyrimidin-5-imine.
| Compound Name | 7-[(2S,5R)-4-[bis(4-chlorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-4-methanimidoyl-3-[[(2R)-oxolan-2-yl]methyl]triazolo[4,5-d]pyrimidin-5-imine |
|---|---|
| PubChem CID | 170445749 |
| Molecular Formula | C29H33Cl2N9O |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | 7-[(2S,5R)-4-[bis(4-chlorophenyl)methyl]-2,5-dimethylpiperazin-1-yl]-4-methanimidoyl-3-[[(2R)-oxolan-2-yl]methyl]triazolo[4,5-d]pyrimidin-5-imine |
| SMILES | [H]/N=C/n1/c(=N/[H])nc(N2C[C@@H](C)N(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)C[C@@H]2C)c2nnn(C[C@H]3CCCO3)c21 |
| InChI | InChI=1S/C29H33Cl2N9O/c1-18-15-38(27-25-28(39(17-32)29(33)34-27)40(36-35-25)16-24-4-3-13-41-24)19(2)14-37(18)26(20-5-9-22(30)10-6-20)21-7-11-23(31)12-8-21/h5-12,17-19,24,26,32-33H,3-4,13-16H2,1-2H3/b32-17+,33-29+/t18-,19+,24-/m1/s1 |
| InChIKey | PBEYJYXXMYWEBA-YCOLUMJNSA-N |
| XLogP | 4.74 |
| TPSA | 111.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|