C23H26ClFN2O4 — CID 170447392
4-[5-chloro-6-(hydroxymethyl)-2-pyridinyl]-5-fluoro-2-hydroxy-N-[(2E,4E)-2-methoxy-3,5-dimethylhepta-2,4-dien-4-yl]benzamide (PubChem CID 170447392) has the molecular formula C23H26ClFN2O4 and a molecular weight of 448.92 g/mol. Its IUPAC name is 4-[5-chloro-6-(hydroxymethyl)-2-pyridinyl]-5-fluoro-2-hydroxy-N-[(2E,4E)-2-methoxy-3,5-dimethylhepta-2,4-dien-4-yl]benzamide.
| Compound Name | 4-[5-chloro-6-(hydroxymethyl)-2-pyridinyl]-5-fluoro-2-hydroxy-N-[(2E,4E)-2-methoxy-3,5-dimethylhepta-2,4-dien-4-yl]benzamide |
|---|---|
| PubChem CID | 170447392 |
| Molecular Formula | C23H26ClFN2O4 |
| Molecular Weight | 448.92 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 4-[5-chloro-6-(hydroxymethyl)-2-pyridinyl]-5-fluoro-2-hydroxy-N-[(2E,4E)-2-methoxy-3,5-dimethylhepta-2,4-dien-4-yl]benzamide |
| SMILES | CC/C(C)=C(NC(=O)c1cc(F)c(-c2ccc(Cl)c(CO)n2)cc1O)\C(C)=C(/C)OC |
| InChI | InChI=1S/C23H26ClFN2O4/c1-6-12(2)22(13(3)14(4)31-5)27-23(30)16-9-18(25)15(10-21(16)29)19-8-7-17(24)20(11-28)26-19/h7-10,28-29H,6,11H2,1-5H3,(H,27,30)/b14-13+,22-12+ |
| InChIKey | PFOZFMILCBXKBK-ZXLTYHNJSA-N |
| XLogP | 5.09 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.92 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|