C15H22N6O6S — CID 170452667
tert-butyl (NE)-N-[amino-[[3-(dimethylcarbamoyl)-2-pyridinyl]sulfonylcarbamoylamino]methylidene]carbamate (PubChem CID 170452667) has the molecular formula C15H22N6O6S and a molecular weight of 414.44 g/mol. Its IUPAC name is tert-butyl (NE)-N-[amino-[[3-(dimethylcarbamoyl)-2-pyridinyl]sulfonylcarbamoylamino]methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[amino-[[3-(dimethylcarbamoyl)-2-pyridinyl]sulfonylcarbamoylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 170452667 |
| Molecular Formula | C15H22N6O6S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | tert-butyl (NE)-N-[amino-[[3-(dimethylcarbamoyl)-2-pyridinyl]sulfonylcarbamoylamino]methylidene]carbamate |
| SMILES | CN(C)C(=O)c1cccnc1S(=O)(=O)NC(=O)N/C(N)=N/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N6O6S/c1-15(2,3)27-14(24)19-12(16)18-13(23)20-28(25,26)10-9(7-6-8-17-10)11(22)21(4)5/h6-8H,1-5H3,(H4,16,18,19,20,23,24) |
| InChIKey | MOYWIEZAOJRJKL-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 173.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|