C24H17N5O3S — CID 170453994
5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]quinolin-8-ol (PubChem CID 170453994) has the molecular formula C24H17N5O3S and a molecular weight of 455.50 g/mol. Its IUPAC name is 5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]quinolin-8-ol.
| Compound Name | 5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 170453994 |
| Molecular Formula | C24H17N5O3S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | 5-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanylmethyl]quinolin-8-ol |
| SMILES | O=[N+]([O-])c1ccc(-c2nnc(SCc3ccc(O)c4ncccc34)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H17N5O3S/c30-21-13-10-17(20-7-4-14-25-22(20)21)15-33-24-27-26-23(28(24)18-5-2-1-3-6-18)16-8-11-19(12-9-16)29(31)32/h1-14,30H,15H2 |
| InChIKey | WPHRMEHGQIJQCI-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|