C23H19BrN4O2 — CID 170459481
N-[4-(3-bromoquinolin-6-yl)oxyphenyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide (PubChem CID 170459481) has the molecular formula C23H19BrN4O2 and a molecular weight of 463.34 g/mol. Its IUPAC name is N-[4-(3-bromoquinolin-6-yl)oxyphenyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide.
| Compound Name | N-[4-(3-bromoquinolin-6-yl)oxyphenyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide |
|---|---|
| PubChem CID | 170459481 |
| Molecular Formula | C23H19BrN4O2 |
| Molecular Weight | 463.34 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | N-[4-(3-bromoquinolin-6-yl)oxyphenyl]-3-(3-but-3-ynyldiazirin-3-yl)propanamide |
| SMILES | C#CCCC1(CCC(=O)Nc2ccc(Oc3ccc4ncc(Br)cc4c3)cc2)N=N1 |
| InChI | InChI=1S/C23H19BrN4O2/c1-2-3-11-23(27-28-23)12-10-22(29)26-18-4-6-19(7-5-18)30-20-8-9-21-16(14-20)13-17(24)15-25-21/h1,4-9,13-15H,3,10-12H2,(H,26,29) |
| InChIKey | VFAZMPGSNIQSFY-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.34 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|