C30H42O4Sn — CID 170459764
[(E)-1,2-bis(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-tributylstannane (PubChem CID 170459764) has the molecular formula C30H42O4Sn and a molecular weight of 585.37 g/mol. Its IUPAC name is [(E)-1,2-bis(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-tributylstannane.
| Compound Name | [(E)-1,2-bis(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-tributylstannane |
|---|---|
| PubChem CID | 170459764 |
| Molecular Formula | C30H42O4Sn |
| Molecular Weight | 585.37 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | [(E)-1,2-bis(2,3-dihydro-1,4-benzodioxin-6-yl)ethenyl]-tributylstannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/c1ccc2c(c1)OCCO2)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H15O4.3C4H9.Sn/c1(13-3-5-15-17(11-13)21-9-7-19-15)2-14-4-6-16-18(12-14)22-10-8-20-16;3*1-3-4-2;/h1,3-6,11-12H,7-10H2;3*1,3-4H2,2H3; |
| InChIKey | QGPDOVVWWCBEGR-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.37 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|