C22H35NO3Sn — CID 131741744
(E)-3-(1,3-benzodioxol-5-yl)-2-tributylstannylprop-2-enamide (PubChem CID 131741744) has the molecular formula C22H35NO3Sn and a molecular weight of 480.24 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-2-tributylstannylprop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-2-tributylstannylprop-2-enamide |
|---|---|
| PubChem CID | 131741744 |
| Molecular Formula | C22H35NO3Sn |
| Molecular Weight | 480.24 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-2-tributylstannylprop-2-enamide |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/c1ccc2c(c1)OCO2)C(N)=O |
| InChI | InChI=1S/C10H8NO3.3C4H9.Sn/c11-10(12)4-2-7-1-3-8-9(5-7)14-6-13-8;3*1-3-4-2;/h1-3,5H,6H2,(H2,11,12);3*1,3-4H2,2H3; |
| InChIKey | HWWKFEVHRAOKGD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.24 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|