C18H24O5 — CID 139651165
3-(1,3-benzodioxol-5-yl)-2-(2-ethylhexoxy)prop-2-enoic acid (PubChem CID 139651165) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-(2-ethylhexoxy)prop-2-enoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-(2-ethylhexoxy)prop-2-enoic acid |
|---|---|
| PubChem CID | 139651165 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-(2-ethylhexoxy)prop-2-enoic acid |
| SMILES | CCCCC(CC)COC(=Cc1ccc2c(c1)OCO2)C(=O)O |
| InChI | InChI=1S/C18H24O5/c1-3-5-6-13(4-2)11-21-17(18(19)20)10-14-7-8-15-16(9-14)23-12-22-15/h7-10,13H,3-6,11-12H2,1-2H3,(H,19,20) |
| InChIKey | PKSUNJVATUJVCL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|