3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid

C19H23NO4 — CID 54232446

IUPAC3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid
SMILESCCCCC(CC)CC(=C(C#N)C(=O)O)c1ccc2c(c1)OCO2
InChIInChI=1S/C19H23NO4/c1-3-5-6-13(4-2)9-15(16(11-20)19(21)22)14-7-8-17-18(10-14)24-12-23-17/h7-8,10,13H,3-6,9,12H2,1-2H3,(H,21,22)
InChIKeyQKFLWPWFJUYGAP-UHFFFAOYSA-N
MW329.40 g/mol
LogP4.38
Rot. Bonds8

About 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid

3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid (PubChem CID 54232446) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid.

Molecular Properties

Compound Name3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid
PubChem CID54232446
Molecular FormulaC19H23NO4
Molecular Weight329.40 g/mol
Exact Mass329.16
IUPAC Name3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid
SMILESCCCCC(CC)CC(=C(C#N)C(=O)O)c1ccc2c(c1)OCO2
InChIInChI=1S/C19H23NO4/c1-3-5-6-13(4-2)9-15(16(11-20)19(21)22)14-7-8-17-18(10-14)24-12-23-17/h7-8,10,13H,3-6,9,12H2,1-2H3,(H,21,22)
InChIKeyQKFLWPWFJUYGAP-UHFFFAOYSA-N
XLogP4.38
TPSA79.55 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.40
LogP ≤ 54.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid?
The IUPAC name of 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid (CID 54232446) is 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid.
What is the SMILES notation for 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid?
The canonical SMILES for 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid is CCCCC(CC)CC(=C(C#N)C(=O)O)c1ccc2c(c1)OCO2.
What is the InChIKey of 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid?
The InChIKey is QKFLWPWFJUYGAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO4/c1-3-5-6-13(4-2)9-15(16(11-20)19(21)22)14-7-8-17-18(10-14)24-12-23-17/h7-8,10,13H,3-6,9,12H2,1-2H3,(H,21,22).
What are the key properties of 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid?
3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid has a molecular weight of 329.40 g/mol, XLogP of 4.38, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid is sourced from PubChem (CID 54232446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).