C19H23NO4 — CID 54232446
3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid (PubChem CID 54232446) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid |
|---|---|
| PubChem CID | 54232446 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-cyano-5-ethylnon-2-enoic acid |
| SMILES | CCCCC(CC)CC(=C(C#N)C(=O)O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H23NO4/c1-3-5-6-13(4-2)9-15(16(11-20)19(21)22)14-7-8-17-18(10-14)24-12-23-17/h7-8,10,13H,3-6,9,12H2,1-2H3,(H,21,22) |
| InChIKey | QKFLWPWFJUYGAP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|