C12H14N2S — CID 170464293
2-[4-(methylamino)but-1-ynyl]benzenecarbothioamide (PubChem CID 170464293) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-[4-(methylamino)but-1-ynyl]benzenecarbothioamide.
| Compound Name | 2-[4-(methylamino)but-1-ynyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 170464293 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-[4-(methylamino)but-1-ynyl]benzenecarbothioamide |
| SMILES | CNCCC#Cc1ccccc1C(N)=S |
| InChI | InChI=1S/C12H14N2S/c1-14-9-5-4-7-10-6-2-3-8-11(10)12(13)15/h2-3,6,8,14H,5,9H2,1H3,(H2,13,15) |
| InChIKey | GIHYMLQWYHAJQS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|